List of top Chemistry Questions asked in KEAM

The element with atomic number 111 was first named as Unununnium. What is its IUPAC name?
Which order is correct in spectrochemical series of ligands:
The tetrahedral crystal field splitting is only____of the octahedral splitting. 

Match the following complexes (P) with the geometry (Q)

 P Q
a[Cu(NH3)4]2+iTetrahedral
b[Ag(NH3)2]+ iiOctahedral
cFe(CO)5iiiSquare planar
d[Cr(H2O)6]3+ivTriagonal bipyramidal
e[NiCl4]2- vLinear 

Find the compounds P and Q in the following reactions:

What are the products of the following reactions?

Which of the following cannot act as a nucleophile?
Which of the following is the most stable carbocation?
 

Which are the non-benzenoid aromatic compounds in the following?
 

non-benzenoid aromatic compounds
Which of the following contains sp hybridised carbon atom?
The basic character of the hydrides of 15 group elements decreases in the order:
Which of the following compounds extensively has Mg as an important element in the living world? 

The geometry of [NiCl4]2- and [Ni(CN)4]2- ions are:

The shape of XeOF4 molecule is:

The number of S-S bonds and the number of lone pairs in S8 molecule,respectively,are:
Which of the following compounds is known as inorganic benzene?

The hybridisation of Xe in XeF2,is:

Find the WRONG statement from the following lists:
Which of the following statements is WRONG?
The correct order of variation of first ionisation enthalpies is:
Which of the following statement cannot be explained by the proposals of Dalton's atomic theory?
The number of electrons in one mole of methane:

What is the major product in the following reaction? 

                   CH3-CH2-CH2-CH=CH2+HBr\(\to\)

Identify 1 and 2 in the following reaction:

Which compound will not take part in the Friedel-Crafts acylation?