List-I | List-II | ||
---|---|---|---|
(A) | Cd(s)+2Ni(OH)3(s)→CdO(s)+2Ni(OH)2(s)+H2O(l) | (I) | Primary battery |
(B) | Zn(Hg)+HgO(s)→ZnO(s)+Hg(l) | (II) | Discharging of secondary battery |
(C) | 2PbSO4(s)+2H2O(l)→Pb(s)+PbO2(s)+2H2SO4(aq) | (III) | Fuel cell |
(D) | 2H2(g)+O2(g)→2H2O(l) | (IV) | Charging of secondary battery |
Choose the correct answer from the options given below:
From the given options the correct answer is option (C): (A) - (II), (B) - (I), (C) - (IV), (D) - (III)
The number of oxygen atoms present in chemical formula of fuming sulphuric acid is _______.