If a straight line in XY plane is passes through \((-a,-b),(a,b),(k,k),(a^2,a^3)\) for some real number \(a,b\) and \(k\),where \(a≠0\),then which of the following option is correct?
Match the following complexes (P) with the geometry (Q)
Find the compounds P and Q in the following reactions:
What are the products of the following reactions?
Which are the non-benzenoid aromatic compounds in the following?
The geometry of [NiCl4]2- and [Ni(CN)4]2- ions are:
The shape of XeOF4 molecule is:
The hybridisation of Xe in XeF2,is:
What is the major product in the following reaction?
CH3-CH2-CH2-CH=CH2+HBr\(\to\)
Identify 1 and 2 in the following reaction: